C23H24F3N5O3 — CID 44765099
benzyl N-[4-oxo-4-[2-[8-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]pyrrolidin-1-yl]butyl]carbamate (PubChem CID 44765099) has the molecular formula C23H24F3N5O3 and a molecular weight of 475.47 g/mol. Its IUPAC name is benzyl N-[4-oxo-4-[2-[8-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]pyrrolidin-1-yl]butyl]carbamate.
| Compound Name | benzyl N-[4-oxo-4-[2-[8-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]pyrrolidin-1-yl]butyl]carbamate |
|---|---|
| PubChem CID | 44765099 |
| Molecular Formula | C23H24F3N5O3 |
| Molecular Weight | 475.47 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | benzyl N-[4-oxo-4-[2-[8-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]pyrrolidin-1-yl]butyl]carbamate |
| SMILES | O=C(NCCCC(=O)N1CCCC1c1nnc2c(C(F)(F)F)cccn12)OCc1ccccc1 |
| InChI | InChI=1S/C23H24F3N5O3/c24-23(25,26)17-9-5-14-31-20(17)28-29-21(31)18-10-6-13-30(18)19(32)11-4-12-27-22(33)34-15-16-7-2-1-3-8-16/h1-3,5,7-9,14,18H,4,6,10-13,15H2,(H,27,33) |
| InChIKey | RXGKOKZGFQOUSH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|