C24H27FN4O — CID 44783549
[3-(1H-benzimidazol-2-yl)-4-[(4-fluorophenyl)methyl]piperazin-1-yl]-cyclopentylmethanone (PubChem CID 44783549) has the molecular formula C24H27FN4O and a molecular weight of 406.51 g/mol. Its IUPAC name is [3-(1H-benzimidazol-2-yl)-4-[(4-fluorophenyl)methyl]piperazin-1-yl]-cyclopentylmethanone.
| Compound Name | [3-(1H-benzimidazol-2-yl)-4-[(4-fluorophenyl)methyl]piperazin-1-yl]-cyclopentylmethanone |
|---|---|
| PubChem CID | 44783549 |
| Molecular Formula | C24H27FN4O |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | [3-(1H-benzimidazol-2-yl)-4-[(4-fluorophenyl)methyl]piperazin-1-yl]-cyclopentylmethanone |
| SMILES | O=C(C1CCCC1)N1CCN(Cc2ccc(F)cc2)C(c2nc3ccccc3[nH]2)C1 |
| InChI | InChI=1S/C24H27FN4O/c25-19-11-9-17(10-12-19)15-28-13-14-29(24(30)18-5-1-2-6-18)16-22(28)23-26-20-7-3-4-8-21(20)27-23/h3-4,7-12,18,22H,1-2,5-6,13-16H2,(H,26,27) |
| InChIKey | KKYPCBAJJOOWJX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |