C20H23FN4O2S — CID 44783552
2-[4-ethylsulfonyl-1-[(4-fluorophenyl)methyl]piperazin-2-yl]-1H-benzimidazole (PubChem CID 44783552) has the molecular formula C20H23FN4O2S and a molecular weight of 402.50 g/mol. Its IUPAC name is 2-[4-ethylsulfonyl-1-[(4-fluorophenyl)methyl]piperazin-2-yl]-1H-benzimidazole.
| Compound Name | 2-[4-ethylsulfonyl-1-[(4-fluorophenyl)methyl]piperazin-2-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 44783552 |
| Molecular Formula | C20H23FN4O2S |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 2-[4-ethylsulfonyl-1-[(4-fluorophenyl)methyl]piperazin-2-yl]-1H-benzimidazole |
| SMILES | CCS(=O)(=O)N1CCN(Cc2ccc(F)cc2)C(c2nc3ccccc3[nH]2)C1 |
| InChI | InChI=1S/C20H23FN4O2S/c1-2-28(26,27)25-12-11-24(13-15-7-9-16(21)10-8-15)19(14-25)20-22-17-5-3-4-6-18(17)23-20/h3-10,19H,2,11-14H2,1H3,(H,22,23) |
| InChIKey | ZRSABCQVJVJODG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |