C18H22N4O2S2 — CID 44783569
2-[1-ethylsulfonyl-4-(thiophen-2-ylmethyl)piperazin-2-yl]-1H-benzimidazole (PubChem CID 44783569) has the molecular formula C18H22N4O2S2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 2-[1-ethylsulfonyl-4-(thiophen-2-ylmethyl)piperazin-2-yl]-1H-benzimidazole.
| Compound Name | 2-[1-ethylsulfonyl-4-(thiophen-2-ylmethyl)piperazin-2-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 44783569 |
| Molecular Formula | C18H22N4O2S2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 2-[1-ethylsulfonyl-4-(thiophen-2-ylmethyl)piperazin-2-yl]-1H-benzimidazole |
| SMILES | CCS(=O)(=O)N1CCN(Cc2cccs2)CC1c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H22N4O2S2/c1-2-26(23,24)22-10-9-21(12-14-6-5-11-25-14)13-17(22)18-19-15-7-3-4-8-16(15)20-18/h3-8,11,17H,2,9-10,12-13H2,1H3,(H,19,20) |
| InChIKey | VPVKCVNOSIBEMR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |