C21H22F3NO7 — CID 44815823
2,4,5-trifluoro-N-[(1R)-1-phenylethyl]-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzamide (PubChem CID 44815823) has the molecular formula C21H22F3NO7 and a molecular weight of 457.40 g/mol. Its IUPAC name is 2,4,5-trifluoro-N-[(1R)-1-phenylethyl]-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzamide.
| Compound Name | 2,4,5-trifluoro-N-[(1R)-1-phenylethyl]-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzamide |
|---|---|
| PubChem CID | 44815823 |
| Molecular Formula | C21H22F3NO7 |
| Molecular Weight | 457.40 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 2,4,5-trifluoro-N-[(1R)-1-phenylethyl]-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzamide |
| SMILES | C[C@@H](NC(=O)c1cc(F)c(F)c(OC2OC(CO)C(O)C(O)C2O)c1F)c1ccccc1 |
| InChI | InChI=1S/C21H22F3NO7/c1-9(10-5-3-2-4-6-10)25-20(30)11-7-12(22)15(24)19(14(11)23)32-21-18(29)17(28)16(27)13(8-26)31-21/h2-7,9,13,16-18,21,26-29H,8H2,1H3,(H,25,30)/t9-,13?,16?,17?,18?,21?/m1/s1 |
| InChIKey | FIQVFXHAARRYHW-OUBJYQTFSA-N |
| XLogP | 0.77 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.40 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|