C18H24O7 — CID 44817209
5-O,5-O'-diethyl 1-O-methyl (1R,2E,3aR,6aS)-2-ethylidene-3-oxo-3a,4,6,6a-tetrahydro-1H-pentalene-1,5,5-tricarboxylate (PubChem CID 44817209) has the molecular formula C18H24O7 and a molecular weight of 352.38 g/mol. Its IUPAC name is 5-O,5-O'-diethyl 1-O-methyl (1R,2E,3aR,6aS)-2-ethylidene-3-oxo-3a,4,6,6a-tetrahydro-1H-pentalene-1,5,5-tricarboxylate.
| Compound Name | 5-O,5-O'-diethyl 1-O-methyl (1R,2E,3aR,6aS)-2-ethylidene-3-oxo-3a,4,6,6a-tetrahydro-1H-pentalene-1,5,5-tricarboxylate |
|---|---|
| PubChem CID | 44817209 |
| Molecular Formula | C18H24O7 |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 5-O,5-O'-diethyl 1-O-methyl (1R,2E,3aR,6aS)-2-ethylidene-3-oxo-3a,4,6,6a-tetrahydro-1H-pentalene-1,5,5-tricarboxylate |
| SMILES | C/C=C1/C(=O)[C@@H]2CC(C(=O)OCC)(C(=O)OCC)C[C@@H]2[C@H]1C(=O)OC |
| InChI | InChI=1S/C18H24O7/c1-5-10-13(15(20)23-4)11-8-18(16(21)24-6-2,17(22)25-7-3)9-12(11)14(10)19/h5,11-13H,6-9H2,1-4H3/b10-5+/t11-,12+,13-/m0/s1 |
| InChIKey | OKAGTDZWFNHEPW-ZFNYCVFOSA-N |
| XLogP | 1.44 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|