C19H28O6 — CID 134867059
diethyl 2-[[(1S,2R)-2-formyl-5-oxocyclopentyl]methyl]-2-(3-methylbut-2-enyl)propanedioate (PubChem CID 134867059) has the molecular formula C19H28O6 and a molecular weight of 352.43 g/mol. Its IUPAC name is diethyl 2-[[(1S,2R)-2-formyl-5-oxocyclopentyl]methyl]-2-(3-methylbut-2-enyl)propanedioate.
| Compound Name | diethyl 2-[[(1S,2R)-2-formyl-5-oxocyclopentyl]methyl]-2-(3-methylbut-2-enyl)propanedioate |
|---|---|
| PubChem CID | 134867059 |
| Molecular Formula | C19H28O6 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | diethyl 2-[[(1S,2R)-2-formyl-5-oxocyclopentyl]methyl]-2-(3-methylbut-2-enyl)propanedioate |
| SMILES | CCOC(=O)C(CC=C(C)C)(C[C@@H]1C(=O)CC[C@H]1C=O)C(=O)OCC |
| InChI | InChI=1S/C19H28O6/c1-5-24-17(22)19(10-9-13(3)4,18(23)25-6-2)11-15-14(12-20)7-8-16(15)21/h9,12,14-15H,5-8,10-11H2,1-4H3/t14-,15-/m0/s1 |
| InChIKey | NSIQQEACGBVBPY-GJZGRUSLSA-N |
| XLogP | 2.64 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|