C24H36O9 — CID 134867414
diethyl 2-[[(1S,2R)-2-(1,2-diacetyloxyethyl)-5-oxocyclopentyl]methyl]-2-(3-methylbut-2-enyl)propanedioate (PubChem CID 134867414) has the molecular formula C24H36O9 and a molecular weight of 468.54 g/mol. Its IUPAC name is diethyl 2-[[(1S,2R)-2-(1,2-diacetyloxyethyl)-5-oxocyclopentyl]methyl]-2-(3-methylbut-2-enyl)propanedioate.
| Compound Name | diethyl 2-[[(1S,2R)-2-(1,2-diacetyloxyethyl)-5-oxocyclopentyl]methyl]-2-(3-methylbut-2-enyl)propanedioate |
|---|---|
| PubChem CID | 134867414 |
| Molecular Formula | C24H36O9 |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | diethyl 2-[[(1S,2R)-2-(1,2-diacetyloxyethyl)-5-oxocyclopentyl]methyl]-2-(3-methylbut-2-enyl)propanedioate |
| SMILES | CCOC(=O)C(CC=C(C)C)(C[C@@H]1C(=O)CC[C@H]1C(COC(C)=O)OC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C24H36O9/c1-7-30-22(28)24(12-11-15(3)4,23(29)31-8-2)13-19-18(9-10-20(19)27)21(33-17(6)26)14-32-16(5)25/h11,18-19,21H,7-10,12-14H2,1-6H3/t18-,19+,21?/m1/s1 |
| InChIKey | DXROVJXXQUIELT-QSJYAPKHSA-N |
| XLogP | 2.94 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|