C30H46O9 — CID 10437560
dimethyl 2-[(1R,3R)-2-[(E,3S)-1-ethoxy-1-oxodec-4-en-3-yl]-3-[(Z)-7-methoxy-7-oxohept-2-enyl]-4-oxocyclopentyl]propanedioate (PubChem CID 10437560) has the molecular formula C30H46O9 and a molecular weight of 550.69 g/mol. Its IUPAC name is dimethyl 2-[(1R,3R)-2-[(E,3S)-1-ethoxy-1-oxodec-4-en-3-yl]-3-[(Z)-7-methoxy-7-oxohept-2-enyl]-4-oxocyclopentyl]propanedioate.
| Compound Name | dimethyl 2-[(1R,3R)-2-[(E,3S)-1-ethoxy-1-oxodec-4-en-3-yl]-3-[(Z)-7-methoxy-7-oxohept-2-enyl]-4-oxocyclopentyl]propanedioate |
|---|---|
| PubChem CID | 10437560 |
| Molecular Formula | C30H46O9 |
| Molecular Weight | 550.69 g/mol |
| Exact Mass | 550.31 |
| IUPAC Name | dimethyl 2-[(1R,3R)-2-[(E,3S)-1-ethoxy-1-oxodec-4-en-3-yl]-3-[(Z)-7-methoxy-7-oxohept-2-enyl]-4-oxocyclopentyl]propanedioate |
| SMILES | CCCCC/C=C/C(CC(=O)OCC)C1[C@H](C(C(=O)OC)C(=O)OC)CC(=O)[C@@H]1C/C=C\CCCC(=O)OC |
| InChI | InChI=1S/C30H46O9/c1-6-8-9-10-13-16-21(19-26(33)39-7-2)27-22(17-14-11-12-15-18-25(32)36-3)24(31)20-23(27)28(29(34)37-4)30(35)38-5/h11,13-14,16,21-23,27-28H,6-10,12,15,17-20H2,1-5H3/b14-11-,16-13+/t21?,22-,23+,27?/m0/s1 |
| InChIKey | MNFZUONZZAULQA-INOXYIPUSA-N |
| XLogP | 4.77 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.69 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|