C23H37FO4 — CID 54277853
ethyl 2-fluoro-7-[(1R,2S)-2-(7-methyloct-6-enyl)-5-oxocyclopentyl]-3-oxoheptanoate (PubChem CID 54277853) has the molecular formula C23H37FO4 and a molecular weight of 396.54 g/mol. Its IUPAC name is ethyl 2-fluoro-7-[(1R,2S)-2-(7-methyloct-6-enyl)-5-oxocyclopentyl]-3-oxoheptanoate.
| Compound Name | ethyl 2-fluoro-7-[(1R,2S)-2-(7-methyloct-6-enyl)-5-oxocyclopentyl]-3-oxoheptanoate |
|---|---|
| PubChem CID | 54277853 |
| Molecular Formula | C23H37FO4 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | ethyl 2-fluoro-7-[(1R,2S)-2-(7-methyloct-6-enyl)-5-oxocyclopentyl]-3-oxoheptanoate |
| SMILES | CCOC(=O)C(F)C(=O)CCCC[C@H]1C(=O)CC[C@@H]1CCCCCC=C(C)C |
| InChI | InChI=1S/C23H37FO4/c1-4-28-23(27)22(24)21(26)14-10-9-13-19-18(15-16-20(19)25)12-8-6-5-7-11-17(2)3/h11,18-19,22H,4-10,12-16H2,1-3H3/t18-,19+,22?/m0/s1 |
| InChIKey | RORGQSOLBGBKLE-ZKTCVHQMSA-N |
| XLogP | 5.53 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|