C24H39FO5 — CID 57186581
ethyl 8-[(1R,2R)-2-[(4R)-4-(fluoromethyl)oct-1-enyl]-5-oxocyclopentyl]-2-hydroxy-3-oxooctanoate (PubChem CID 57186581) has the molecular formula C24H39FO5 and a molecular weight of 426.57 g/mol. Its IUPAC name is ethyl 8-[(1R,2R)-2-[(4R)-4-(fluoromethyl)oct-1-enyl]-5-oxocyclopentyl]-2-hydroxy-3-oxooctanoate.
| Compound Name | ethyl 8-[(1R,2R)-2-[(4R)-4-(fluoromethyl)oct-1-enyl]-5-oxocyclopentyl]-2-hydroxy-3-oxooctanoate |
|---|---|
| PubChem CID | 57186581 |
| Molecular Formula | C24H39FO5 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | ethyl 8-[(1R,2R)-2-[(4R)-4-(fluoromethyl)oct-1-enyl]-5-oxocyclopentyl]-2-hydroxy-3-oxooctanoate |
| SMILES | CCCC[C@@H](CF)CC=C[C@H]1CCC(=O)[C@@H]1CCCCCC(=O)C(O)C(=O)OCC |
| InChI | InChI=1S/C24H39FO5/c1-3-5-10-18(17-25)11-9-12-19-15-16-21(26)20(19)13-7-6-8-14-22(27)23(28)24(29)30-4-2/h9,12,18-20,23,28H,3-8,10-11,13-17H2,1-2H3/t18-,19+,20-,23?/m1/s1 |
| InChIKey | QCEZEMKNSSQFHW-MLJUJGDHSA-N |
| XLogP | 4.75 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|