C23H30O8 — CID 15193894
trimethyl (3aR,4E,6E,15aR)-1,13-dioxo-3,3a,8,10,11,12,14,15-octahydro-2H-cyclopenta[14]annulene-9,9,15a-tricarboxylate (PubChem CID 15193894) has the molecular formula C23H30O8 and a molecular weight of 434.49 g/mol. Its IUPAC name is trimethyl (3aR,4E,6E,15aR)-1,13-dioxo-3,3a,8,10,11,12,14,15-octahydro-2H-cyclopenta[14]annulene-9,9,15a-tricarboxylate.
| Compound Name | trimethyl (3aR,4E,6E,15aR)-1,13-dioxo-3,3a,8,10,11,12,14,15-octahydro-2H-cyclopenta[14]annulene-9,9,15a-tricarboxylate |
|---|---|
| PubChem CID | 15193894 |
| Molecular Formula | C23H30O8 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | trimethyl (3aR,4E,6E,15aR)-1,13-dioxo-3,3a,8,10,11,12,14,15-octahydro-2H-cyclopenta[14]annulene-9,9,15a-tricarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C/C=C/C=C/[C@H]2CCC(=O)[C@@]2(C(=O)OC)CCC(=O)CCC1 |
| InChI | InChI=1S/C23H30O8/c1-29-19(26)22(20(27)30-2)13-6-4-5-8-16-10-11-18(25)23(16,21(28)31-3)15-12-17(24)9-7-14-22/h4-6,8,16H,7,9-15H2,1-3H3/b6-4+,8-5+/t16-,23+/m0/s1 |
| InChIKey | RAHLGNMKVZUZDF-KFWAZTJESA-N |
| XLogP | 2.49 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|