C16H22O7 — CID 102317458
trimethyl (3Z)-8-oxocyclodec-3-ene-1,1,6-tricarboxylate (PubChem CID 102317458) has the molecular formula C16H22O7 and a molecular weight of 326.35 g/mol. Its IUPAC name is trimethyl (3Z)-8-oxocyclodec-3-ene-1,1,6-tricarboxylate.
| Compound Name | trimethyl (3Z)-8-oxocyclodec-3-ene-1,1,6-tricarboxylate |
|---|---|
| PubChem CID | 102317458 |
| Molecular Formula | C16H22O7 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | trimethyl (3Z)-8-oxocyclodec-3-ene-1,1,6-tricarboxylate |
| SMILES | COC(=O)C1C/C=C\CC(C(=O)OC)(C(=O)OC)CCC(=O)C1 |
| InChI | InChI=1S/C16H22O7/c1-21-13(18)11-6-4-5-8-16(14(19)22-2,15(20)23-3)9-7-12(17)10-11/h4-5,11H,6-10H2,1-3H3/b5-4- |
| InChIKey | RBOOFLPKPPYTAA-PLNGDYQASA-N |
| XLogP | 1.20 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|