C26H38O4 — CID 53364436
methyl (1S,5R)-3-acetyl-5-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methyl-1-(3-methylbut-2-enyl)-2-oxocyclohex-3-ene-1-carboxylate (PubChem CID 53364436) has the molecular formula C26H38O4 and a molecular weight of 414.59 g/mol. Its IUPAC name is methyl (1S,5R)-3-acetyl-5-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methyl-1-(3-methylbut-2-enyl)-2-oxocyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1S,5R)-3-acetyl-5-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methyl-1-(3-methylbut-2-enyl)-2-oxocyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 53364436 |
| Molecular Formula | C26H38O4 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | methyl (1S,5R)-3-acetyl-5-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methyl-1-(3-methylbut-2-enyl)-2-oxocyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@@]1(CC=C(C)C)C[C@@H](C/C=C(\C)CCC=C(C)C)C(C)=C(C(C)=O)C1=O |
| InChI | InChI=1S/C26H38O4/c1-17(2)10-9-11-19(5)12-13-22-16-26(25(29)30-8,15-14-18(3)4)24(28)23(20(22)6)21(7)27/h10,12,14,22H,9,11,13,15-16H2,1-8H3/b19-12+/t22-,26+/m1/s1 |
| InChIKey | POTZEPBMEFJREZ-LHFOCNNESA-N |
| XLogP | 6.08 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|