C21H34O4 — CID 162397530
diethyl (4R)-3,3-dimethyl-4-[(2E)-6-methylhepta-2,5-dien-2-yl]cyclopentane-1,1-dicarboxylate (PubChem CID 162397530) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is diethyl (4R)-3,3-dimethyl-4-[(2E)-6-methylhepta-2,5-dien-2-yl]cyclopentane-1,1-dicarboxylate.
| Compound Name | diethyl (4R)-3,3-dimethyl-4-[(2E)-6-methylhepta-2,5-dien-2-yl]cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 162397530 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | diethyl (4R)-3,3-dimethyl-4-[(2E)-6-methylhepta-2,5-dien-2-yl]cyclopentane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@@H](/C(C)=C/CC=C(C)C)C(C)(C)C1 |
| InChI | InChI=1S/C21H34O4/c1-8-24-18(22)21(19(23)25-9-2)13-17(20(6,7)14-21)16(5)12-10-11-15(3)4/h11-12,17H,8-10,13-14H2,1-7H3/b16-12+/t17-/m0/s1 |
| InChIKey | RZOPTHQDZVLEAI-MOKGIYGOSA-N |
| XLogP | 4.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|