C23H21BrClNO3S — CID 44817450
N-[(1R,2S)-1-bromo-1-(4-chlorophenyl)-3-oxo-3-phenylpropan-2-yl]-N,4-dimethylbenzenesulfonamide (PubChem CID 44817450) has the molecular formula C23H21BrClNO3S and a molecular weight of 506.85 g/mol. Its IUPAC name is N-[(1R,2S)-1-bromo-1-(4-chlorophenyl)-3-oxo-3-phenylpropan-2-yl]-N,4-dimethylbenzenesulfonamide.
| Compound Name | N-[(1R,2S)-1-bromo-1-(4-chlorophenyl)-3-oxo-3-phenylpropan-2-yl]-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 44817450 |
| Molecular Formula | C23H21BrClNO3S |
| Molecular Weight | 506.85 g/mol |
| Exact Mass | 505.01 |
| IUPAC Name | N-[(1R,2S)-1-bromo-1-(4-chlorophenyl)-3-oxo-3-phenylpropan-2-yl]-N,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)[C@@H](C(=O)c2ccccc2)[C@H](Br)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H21BrClNO3S/c1-16-8-14-20(15-9-16)30(28,29)26(2)22(23(27)18-6-4-3-5-7-18)21(24)17-10-12-19(25)13-11-17/h3-15,21-22H,1-2H3/t21-,22-/m1/s1 |
| InChIKey | KSYVRFZTBWPNDU-FGZHOGPDSA-N |
| XLogP | 5.66 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.85 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|