C23H18ClFN4O — CID 44819220
N-[4-[[(2-chloro-5-methylquinazolin-4-yl)amino]methyl]phenyl]-4-fluorobenzamide (PubChem CID 44819220) has the molecular formula C23H18ClFN4O and a molecular weight of 420.88 g/mol. Its IUPAC name is N-[4-[[(2-chloro-5-methylquinazolin-4-yl)amino]methyl]phenyl]-4-fluorobenzamide.
| Compound Name | N-[4-[[(2-chloro-5-methylquinazolin-4-yl)amino]methyl]phenyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 44819220 |
| Molecular Formula | C23H18ClFN4O |
| Molecular Weight | 420.88 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | N-[4-[[(2-chloro-5-methylquinazolin-4-yl)amino]methyl]phenyl]-4-fluorobenzamide |
| SMILES | Cc1cccc2nc(Cl)nc(NCc3ccc(NC(=O)c4ccc(F)cc4)cc3)c12 |
| InChI | InChI=1S/C23H18ClFN4O/c1-14-3-2-4-19-20(14)21(29-23(24)28-19)26-13-15-5-11-18(12-6-15)27-22(30)16-7-9-17(25)10-8-16/h2-12H,13H2,1H3,(H,27,30)(H,26,28,29) |
| InChIKey | UAIKOCTZVUXZEQ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.88 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |