C27H28FN5O — CID 68945794
N-[4-[[[2-(diethylamino)-7-methylquinazolin-4-yl]amino]methyl]phenyl]-4-fluorobenzamide (PubChem CID 68945794) has the molecular formula C27H28FN5O and a molecular weight of 457.55 g/mol. Its IUPAC name is N-[4-[[[2-(diethylamino)-7-methylquinazolin-4-yl]amino]methyl]phenyl]-4-fluorobenzamide.
| Compound Name | N-[4-[[[2-(diethylamino)-7-methylquinazolin-4-yl]amino]methyl]phenyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 68945794 |
| Molecular Formula | C27H28FN5O |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | N-[4-[[[2-(diethylamino)-7-methylquinazolin-4-yl]amino]methyl]phenyl]-4-fluorobenzamide |
| SMILES | CCN(CC)c1nc(NCc2ccc(NC(=O)c3ccc(F)cc3)cc2)c2ccc(C)cc2n1 |
| InChI | InChI=1S/C27H28FN5O/c1-4-33(5-2)27-31-24-16-18(3)6-15-23(24)25(32-27)29-17-19-7-13-22(14-8-19)30-26(34)20-9-11-21(28)12-10-20/h6-16H,4-5,17H2,1-3H3,(H,30,34)(H,29,31,32) |
| InChIKey | PBBVEJYBMVJMJF-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |