C23H19Cl2N5O — CID 86625919
1-[4-[[(2-chloro-7-methylquinazolin-4-yl)amino]methyl]phenyl]-3-(4-chlorophenyl)urea (PubChem CID 86625919) has the molecular formula C23H19Cl2N5O and a molecular weight of 452.35 g/mol. Its IUPAC name is 1-[4-[[(2-chloro-7-methylquinazolin-4-yl)amino]methyl]phenyl]-3-(4-chlorophenyl)urea.
| Compound Name | 1-[4-[[(2-chloro-7-methylquinazolin-4-yl)amino]methyl]phenyl]-3-(4-chlorophenyl)urea |
|---|---|
| PubChem CID | 86625919 |
| Molecular Formula | C23H19Cl2N5O |
| Molecular Weight | 452.35 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | 1-[4-[[(2-chloro-7-methylquinazolin-4-yl)amino]methyl]phenyl]-3-(4-chlorophenyl)urea |
| SMILES | Cc1ccc2c(NCc3ccc(NC(=O)Nc4ccc(Cl)cc4)cc3)nc(Cl)nc2c1 |
| InChI | InChI=1S/C23H19Cl2N5O/c1-14-2-11-19-20(12-14)29-22(25)30-21(19)26-13-15-3-7-17(8-4-15)27-23(31)28-18-9-5-16(24)6-10-18/h2-12H,13H2,1H3,(H,26,29,30)(H2,27,28,31) |
| InChIKey | JVTSTUNPTCEKRM-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.35 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |