C24H21FIN5O — CID 25026713
N-[4-[[[2-(dimethylamino)-7-iodoquinazolin-4-yl]amino]methyl]phenyl]-4-fluorobenzamide (PubChem CID 25026713) has the molecular formula C24H21FIN5O and a molecular weight of 541.37 g/mol. Its IUPAC name is N-[4-[[[2-(dimethylamino)-7-iodoquinazolin-4-yl]amino]methyl]phenyl]-4-fluorobenzamide.
| Compound Name | N-[4-[[[2-(dimethylamino)-7-iodoquinazolin-4-yl]amino]methyl]phenyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 25026713 |
| Molecular Formula | C24H21FIN5O |
| Molecular Weight | 541.37 g/mol |
| Exact Mass | 541.08 |
| IUPAC Name | N-[4-[[[2-(dimethylamino)-7-iodoquinazolin-4-yl]amino]methyl]phenyl]-4-fluorobenzamide |
| SMILES | CN(C)c1nc(NCc2ccc(NC(=O)c3ccc(F)cc3)cc2)c2ccc(I)cc2n1 |
| InChI | InChI=1S/C24H21FIN5O/c1-31(2)24-29-21-13-18(26)9-12-20(21)22(30-24)27-14-15-3-10-19(11-4-15)28-23(32)16-5-7-17(25)8-6-16/h3-13H,14H2,1-2H3,(H,28,32)(H,27,29,30) |
| InChIKey | ZXEOPBBDKXMHKM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.37 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|