C30H32FN5O — CID 68941623
4-[[[2-(dimethylamino)-6-[(E)-hex-1-enyl]quinazolin-4-yl]amino]methyl]-N-(4-fluorophenyl)benzamide (PubChem CID 68941623) has the molecular formula C30H32FN5O and a molecular weight of 497.62 g/mol. Its IUPAC name is 4-[[[2-(dimethylamino)-6-[(E)-hex-1-enyl]quinazolin-4-yl]amino]methyl]-N-(4-fluorophenyl)benzamide.
| Compound Name | 4-[[[2-(dimethylamino)-6-[(E)-hex-1-enyl]quinazolin-4-yl]amino]methyl]-N-(4-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 68941623 |
| Molecular Formula | C30H32FN5O |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | 4-[[[2-(dimethylamino)-6-[(E)-hex-1-enyl]quinazolin-4-yl]amino]methyl]-N-(4-fluorophenyl)benzamide |
| SMILES | CCCC/C=C/c1ccc2nc(N(C)C)nc(NCc3ccc(C(=O)Nc4ccc(F)cc4)cc3)c2c1 |
| InChI | InChI=1S/C30H32FN5O/c1-4-5-6-7-8-21-11-18-27-26(19-21)28(35-30(34-27)36(2)3)32-20-22-9-12-23(13-10-22)29(37)33-25-16-14-24(31)15-17-25/h7-19H,4-6,20H2,1-3H3,(H,33,37)(H,32,34,35)/b8-7+ |
| InChIKey | BHIOLGCZMCCQKQ-BQYQJAHWSA-N |
| XLogP | 6.90 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|