C14H12N4O4 — CID 44889994
(2R,5R,7R)-10-[2-(4-nitrophenyl)ethyl]-3,6-dioxa-9,10,11-triazatetracyclo[6.3.0.02,4.05,7]undeca-1(11),8-diene (PubChem CID 44889994) has the molecular formula C14H12N4O4 and a molecular weight of 300.27 g/mol. Its IUPAC name is (2R,5R,7R)-10-[2-(4-nitrophenyl)ethyl]-3,6-dioxa-9,10,11-triazatetracyclo[6.3.0.02,4.05,7]undeca-1(11),8-diene.
| Compound Name | (2R,5R,7R)-10-[2-(4-nitrophenyl)ethyl]-3,6-dioxa-9,10,11-triazatetracyclo[6.3.0.02,4.05,7]undeca-1(11),8-diene |
|---|---|
| PubChem CID | 44889994 |
| Molecular Formula | C14H12N4O4 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | (2R,5R,7R)-10-[2-(4-nitrophenyl)ethyl]-3,6-dioxa-9,10,11-triazatetracyclo[6.3.0.02,4.05,7]undeca-1(11),8-diene |
| SMILES | O=[N+]([O-])c1ccc(CCn2nc3c(n2)[C@H]2O[C@H]2C2O[C@H]32)cc1 |
| InChI | InChI=1S/C14H12N4O4/c19-18(20)8-3-1-7(2-4-8)5-6-17-15-9-10(16-17)12-14(22-12)13-11(9)21-13/h1-4,11-14H,5-6H2/t11-,12-,13-,14?/m1/s1 |
| InChIKey | BSFIQLJTMNXYJN-ZHZAVPAVSA-N |
| XLogP | 1.32 |
| TPSA | 98.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|