C22H24FN5O4S2 — CID 44963129
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[6-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-4-oxopyran-3-yl]oxyacetamide (PubChem CID 44963129) has the molecular formula C22H24FN5O4S2 and a molecular weight of 505.60 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[6-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-4-oxopyran-3-yl]oxyacetamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[6-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-4-oxopyran-3-yl]oxyacetamide |
|---|---|
| PubChem CID | 44963129 |
| Molecular Formula | C22H24FN5O4S2 |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[6-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-4-oxopyran-3-yl]oxyacetamide |
| SMILES | CCSc1nnc(NC(=O)COc2coc(CN3CCN(c4ccccc4F)CC3)cc2=O)s1 |
| InChI | InChI=1S/C22H24FN5O4S2/c1-2-33-22-26-25-21(34-22)24-20(30)14-32-19-13-31-15(11-18(19)29)12-27-7-9-28(10-8-27)17-6-4-3-5-16(17)23/h3-6,11,13H,2,7-10,12,14H2,1H3,(H,24,25,30) |
| InChIKey | BCSXVEILSGMHOQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|