C10H18N4O2 — CID 44996002
N'-(4-methylpiperazin-1-yl)-N-prop-2-enyloxamide (PubChem CID 44996002) has the molecular formula C10H18N4O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is N'-(4-methylpiperazin-1-yl)-N-prop-2-enyloxamide.
| Compound Name | N'-(4-methylpiperazin-1-yl)-N-prop-2-enyloxamide |
|---|---|
| PubChem CID | 44996002 |
| Molecular Formula | C10H18N4O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | N'-(4-methylpiperazin-1-yl)-N-prop-2-enyloxamide |
| SMILES | C=CCNC(=O)C(=O)NN1CCN(C)CC1 |
| InChI | InChI=1S/C10H18N4O2/c1-3-4-11-9(15)10(16)12-14-7-5-13(2)6-8-14/h3H,1,4-8H2,2H3,(H,11,15)(H,12,16) |
| InChIKey | PDWCHBGJQHCZBI-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|