C10H20N6O2 — CID 174293230
2-[amino-[(Z)-2-amino-3-(2-oxopiperazin-1-yl)prop-1-enyl]amino]-N-methylacetamide (PubChem CID 174293230) has the molecular formula C10H20N6O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is 2-[amino-[(Z)-2-amino-3-(2-oxopiperazin-1-yl)prop-1-enyl]amino]-N-methylacetamide.
| Compound Name | 2-[amino-[(Z)-2-amino-3-(2-oxopiperazin-1-yl)prop-1-enyl]amino]-N-methylacetamide |
|---|---|
| PubChem CID | 174293230 |
| Molecular Formula | C10H20N6O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 2-[amino-[(Z)-2-amino-3-(2-oxopiperazin-1-yl)prop-1-enyl]amino]-N-methylacetamide |
| SMILES | CNC(=O)CN(N)/C=C(\N)CN1CCNCC1=O |
| InChI | InChI=1S/C10H20N6O2/c1-13-9(17)7-16(12)6-8(11)5-15-3-2-14-4-10(15)18/h6,14H,2-5,7,11-12H2,1H3,(H,13,17)/b8-6- |
| InChIKey | XQZVLEOARAKNRW-VURMDHGXSA-N |
| XLogP | -2.86 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|