C13H22N6O3 — CID 174293241
2-[amino-[(Z)-2-amino-3-(2-oxo-4-prop-2-enoylpiperazin-1-yl)prop-1-enyl]amino]-N-methylacetamide (PubChem CID 174293241) has the molecular formula C13H22N6O3 and a molecular weight of 310.36 g/mol. Its IUPAC name is 2-[amino-[(Z)-2-amino-3-(2-oxo-4-prop-2-enoylpiperazin-1-yl)prop-1-enyl]amino]-N-methylacetamide.
| Compound Name | 2-[amino-[(Z)-2-amino-3-(2-oxo-4-prop-2-enoylpiperazin-1-yl)prop-1-enyl]amino]-N-methylacetamide |
|---|---|
| PubChem CID | 174293241 |
| Molecular Formula | C13H22N6O3 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 2-[amino-[(Z)-2-amino-3-(2-oxo-4-prop-2-enoylpiperazin-1-yl)prop-1-enyl]amino]-N-methylacetamide |
| SMILES | C=CC(=O)N1CCN(C/C(N)=C/N(N)CC(=O)NC)C(=O)C1 |
| InChI | InChI=1S/C13H22N6O3/c1-3-12(21)18-5-4-17(13(22)9-18)6-10(14)7-19(15)8-11(20)16-2/h3,7H,1,4-6,8-9,14-15H2,2H3,(H,16,20)/b10-7- |
| InChIKey | DSYDQOZIXAWCDF-YFHOEESVSA-N |
| XLogP | -2.43 |
| TPSA | 125.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|