C25H19N3O4S — CID 45010463
[2-[(E)-3-[[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]amino]-3-oxoprop-1-enyl]phenyl] benzoate (PubChem CID 45010463) has the molecular formula C25H19N3O4S and a molecular weight of 457.51 g/mol. Its IUPAC name is [2-[(E)-3-[[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]amino]-3-oxoprop-1-enyl]phenyl] benzoate.
| Compound Name | [2-[(E)-3-[[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]amino]-3-oxoprop-1-enyl]phenyl] benzoate |
|---|---|
| PubChem CID | 45010463 |
| Molecular Formula | C25H19N3O4S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | [2-[(E)-3-[[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]amino]-3-oxoprop-1-enyl]phenyl] benzoate |
| SMILES | COc1ccc(-c2nnc(NC(=O)/C=C/c3ccccc3OC(=O)c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C25H19N3O4S/c1-31-20-14-11-18(12-15-20)23-27-28-25(33-23)26-22(29)16-13-17-7-5-6-10-21(17)32-24(30)19-8-3-2-4-9-19/h2-16H,1H3,(H,26,28,29)/b16-13+ |
| InChIKey | QSGQNYMTOJXVRU-DTQAZKPQSA-N |
| XLogP | 5.08 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|