C19H16ClN3O3S — CID 55382707
(E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-(5-phenyl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 55382707) has the molecular formula C19H16ClN3O3S and a molecular weight of 401.88 g/mol. Its IUPAC name is (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-(5-phenyl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-(5-phenyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 55382707 |
| Molecular Formula | C19H16ClN3O3S |
| Molecular Weight | 401.88 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-(5-phenyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2nnc(-c3ccccc3)s2)cc(Cl)c1OC |
| InChI | InChI=1S/C19H16ClN3O3S/c1-25-15-11-12(10-14(20)17(15)26-2)8-9-16(24)21-19-23-22-18(27-19)13-6-4-3-5-7-13/h3-11H,1-2H3,(H,21,23,24)/b9-8+ |
| InChIKey | KXZGPAALMMGGHS-CMDGGOBGSA-N |
| XLogP | 4.53 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.88 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|