C18H19Cl2N7O3S — CID 4502653
N-(2,5-dichlorophenyl)-2-[[4-ethyl-5-[2-(5-methyl-3-nitropyrazol-1-yl)ethyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 4502653) has the molecular formula C18H19Cl2N7O3S and a molecular weight of 484.37 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-[[4-ethyl-5-[2-(5-methyl-3-nitropyrazol-1-yl)ethyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-[[4-ethyl-5-[2-(5-methyl-3-nitropyrazol-1-yl)ethyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 4502653 |
| Molecular Formula | C18H19Cl2N7O3S |
| Molecular Weight | 484.37 g/mol |
| Exact Mass | 483.06 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-[[4-ethyl-5-[2-(5-methyl-3-nitropyrazol-1-yl)ethyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCn1c(CCn2nc([N+](=O)[O-])cc2C)nnc1SCC(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H19Cl2N7O3S/c1-3-25-15(6-7-26-11(2)8-16(24-26)27(29)30)22-23-18(25)31-10-17(28)21-14-9-12(19)4-5-13(14)20/h4-5,8-9H,3,6-7,10H2,1-2H3,(H,21,28) |
| InChIKey | JNDQGRMIXQRDFV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.37 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|