C28H22N6O2 — CID 45028638
(E)-1-[3-[(4,6-dianilino-1,3,5-triazin-2-yl)amino]phenyl]-3-(furan-2-yl)prop-2-en-1-one (PubChem CID 45028638) has the molecular formula C28H22N6O2 and a molecular weight of 474.52 g/mol. Its IUPAC name is (E)-1-[3-[(4,6-dianilino-1,3,5-triazin-2-yl)amino]phenyl]-3-(furan-2-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[3-[(4,6-dianilino-1,3,5-triazin-2-yl)amino]phenyl]-3-(furan-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 45028638 |
| Molecular Formula | C28H22N6O2 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | (E)-1-[3-[(4,6-dianilino-1,3,5-triazin-2-yl)amino]phenyl]-3-(furan-2-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccco1)c1cccc(Nc2nc(Nc3ccccc3)nc(Nc3ccccc3)n2)c1 |
| InChI | InChI=1S/C28H22N6O2/c35-25(17-16-24-15-8-18-36-24)20-9-7-14-23(19-20)31-28-33-26(29-21-10-3-1-4-11-21)32-27(34-28)30-22-12-5-2-6-13-22/h1-19H,(H3,29,30,31,32,33,34)/b17-16+ |
| InChIKey | XSPWDVOYSALMLJ-WUKNDPDISA-N |
| XLogP | 6.59 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|