C16H15ClN4O — CID 45028993
6-amino-5-(4-chlorophenyl)-2-morpholin-4-ylpyridine-3-carbonitrile (PubChem CID 45028993) has the molecular formula C16H15ClN4O and a molecular weight of 314.78 g/mol. Its IUPAC name is 6-amino-5-(4-chlorophenyl)-2-morpholin-4-ylpyridine-3-carbonitrile.
| Compound Name | 6-amino-5-(4-chlorophenyl)-2-morpholin-4-ylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 45028993 |
| Molecular Formula | C16H15ClN4O |
| Molecular Weight | 314.78 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 6-amino-5-(4-chlorophenyl)-2-morpholin-4-ylpyridine-3-carbonitrile |
| SMILES | N#Cc1cc(-c2ccc(Cl)cc2)c(N)nc1N1CCOCC1 |
| InChI | InChI=1S/C16H15ClN4O/c17-13-3-1-11(2-4-13)14-9-12(10-18)16(20-15(14)19)21-5-7-22-8-6-21/h1-4,9H,5-8H2,(H2,19,20) |
| InChIKey | YQPDKOSWVQERSK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 75.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.78 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |