C25H34O6 — CID 45033651
[(1R,4R,6R,10R,13S,14R,17S)-9-acetyloxy-7,14-dimethyl-5,8-dioxahexacyclo[11.8.0.02,10.04,6.06,10.014,19]henicos-19-en-17-yl] acetate (PubChem CID 45033651) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is [(1R,4R,6R,10R,13S,14R,17S)-9-acetyloxy-7,14-dimethyl-5,8-dioxahexacyclo[11.8.0.02,10.04,6.06,10.014,19]henicos-19-en-17-yl] acetate.
| Compound Name | [(1R,4R,6R,10R,13S,14R,17S)-9-acetyloxy-7,14-dimethyl-5,8-dioxahexacyclo[11.8.0.02,10.04,6.06,10.014,19]henicos-19-en-17-yl] acetate |
|---|---|
| PubChem CID | 45033651 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | [(1R,4R,6R,10R,13S,14R,17S)-9-acetyloxy-7,14-dimethyl-5,8-dioxahexacyclo[11.8.0.02,10.04,6.06,10.014,19]henicos-19-en-17-yl] acetate |
| SMILES | CC(=O)OC1OC(C)[C@@]23O[C@@H]2CC2[C@@H]4CC=C5C[C@@H](OC(C)=O)CC[C@]5(C)[C@H]4CC[C@@]123 |
| InChI | InChI=1S/C25H34O6/c1-13-25-21(31-25)12-20-18-6-5-16-11-17(29-14(2)26)7-9-23(16,4)19(18)8-10-24(20,25)22(28-13)30-15(3)27/h5,13,17-22H,6-12H2,1-4H3/t13?,17-,18+,19-,20?,21+,22?,23-,24-,25+/m0/s1 |
| InChIKey | PEPNOELPSBLVLJ-AQXAETANSA-N |
| XLogP | 3.92 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|