C13H9ClN4S — CID 45034036
N-(4-chlorophenyl)-3-pyridin-3-yl-1,2,4-thiadiazol-5-amine (PubChem CID 45034036) has the molecular formula C13H9ClN4S and a molecular weight of 288.76 g/mol. Its IUPAC name is N-(4-chlorophenyl)-3-pyridin-3-yl-1,2,4-thiadiazol-5-amine.
| Compound Name | N-(4-chlorophenyl)-3-pyridin-3-yl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 45034036 |
| Molecular Formula | C13H9ClN4S |
| Molecular Weight | 288.76 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | N-(4-chlorophenyl)-3-pyridin-3-yl-1,2,4-thiadiazol-5-amine |
| SMILES | Clc1ccc(Nc2nc(-c3cccnc3)ns2)cc1 |
| InChI | InChI=1S/C13H9ClN4S/c14-10-3-5-11(6-4-10)16-13-17-12(18-19-13)9-2-1-7-15-8-9/h1-8H,(H,16,17,18) |
| InChIKey | VDBQDYXKJPDIDO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.76 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |