C16H10ClF3N4 — CID 134095406
N-(4-chlorophenyl)-4-pyridin-3-yl-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 134095406) has the molecular formula C16H10ClF3N4 and a molecular weight of 350.73 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-pyridin-3-yl-6-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-(4-chlorophenyl)-4-pyridin-3-yl-6-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 134095406 |
| Molecular Formula | C16H10ClF3N4 |
| Molecular Weight | 350.73 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | N-(4-chlorophenyl)-4-pyridin-3-yl-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | FC(F)(F)c1cc(-c2cccnc2)nc(Nc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C16H10ClF3N4/c17-11-3-5-12(6-4-11)22-15-23-13(10-2-1-7-21-9-10)8-14(24-15)16(18,19)20/h1-9H,(H,22,23,24) |
| InChIKey | YQVJCJIRDNWKCU-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.73 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |