C8H9NO2 — CID 45040504
4,4,5,6,7,7-hexadeuterio-3a,7a-dihydroisoindole-1,3-dione (PubChem CID 45040504) has the molecular formula C8H9NO2 and a molecular weight of 157.20 g/mol. Its IUPAC name is 4,4,5,6,7,7-hexadeuterio-3a,7a-dihydroisoindole-1,3-dione.
| Compound Name | 4,4,5,6,7,7-hexadeuterio-3a,7a-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 45040504 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 157.20 g/mol |
| Exact Mass | 157.10 |
| IUPAC Name | 4,4,5,6,7,7-hexadeuterio-3a,7a-dihydroisoindole-1,3-dione |
| SMILES | [2H]C1=C([2H])C([2H])([2H])C2C(=O)NC(=O)C2C1([2H])[2H] |
| InChI | InChI=1S/C8H9NO2/c10-7-5-3-1-2-4-6(5)8(11)9-7/h1-2,5-6H,3-4H2,(H,9,10,11)/i1D,2D,3D2,4D2 |
| InChIKey | CIFFBTOJCKSRJY-TZCZJOIZSA-N |
| XLogP | 0.23 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.20 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|