C21H34Br2 — CID 45043873
(12R)-11,12-dibromo-17-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 45043873) has the molecular formula C21H34Br2 and a molecular weight of 446.31 g/mol. Its IUPAC name is (12R)-11,12-dibromo-17-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (12R)-11,12-dibromo-17-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 45043873 |
| Molecular Formula | C21H34Br2 |
| Molecular Weight | 446.31 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | (12R)-11,12-dibromo-17-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CCC1CCC2C3CCC4CCCCC4(C)C3C(Br)[C@H](Br)C12C |
| InChI | InChI=1S/C21H34Br2/c1-4-13-9-11-16-15-10-8-14-7-5-6-12-20(14,2)17(15)18(22)19(23)21(13,16)3/h13-19H,4-12H2,1-3H3/t13?,14?,15?,16?,17?,18?,19-,20?,21?/m0/s1 |
| InChIKey | WYNYTPSUJSFJAQ-VCWWRHLISA-N |
| XLogP | 7.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.31 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|