C17H38BrNO5 — CID 45048275
dimethyl-nonyl-(2,3,4,5,6-pentahydroxyhexyl)azanium bromide (PubChem CID 45048275) has the molecular formula C17H38BrNO5 and a molecular weight of 416.40 g/mol. Its IUPAC name is dimethyl-nonyl-(2,3,4,5,6-pentahydroxyhexyl)azanium bromide.
| Compound Name | dimethyl-nonyl-(2,3,4,5,6-pentahydroxyhexyl)azanium bromide |
|---|---|
| PubChem CID | 45048275 |
| Molecular Formula | C17H38BrNO5 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | dimethyl-nonyl-(2,3,4,5,6-pentahydroxyhexyl)azanium bromide |
| SMILES | CCCCCCCCC[N+](C)(C)CC(O)C(O)C(O)C(O)CO.[Br-] |
| InChI | InChI=1S/C17H38NO5.BrH/c1-4-5-6-7-8-9-10-11-18(2,3)12-14(20)16(22)17(23)15(21)13-19;/h14-17,19-23H,4-13H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | PURFHTYROMQFCQ-UHFFFAOYSA-M |
| XLogP | -2.75 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|