C18H21BrN2O3S — CID 45049666
4-[1-[(Z)-3-phenylprop-2-enyl]pyridin-1-ium-3-yl]sulfonylmorpholine bromide (PubChem CID 45049666) has the molecular formula C18H21BrN2O3S and a molecular weight of 425.35 g/mol. Its IUPAC name is 4-[1-[(Z)-3-phenylprop-2-enyl]pyridin-1-ium-3-yl]sulfonylmorpholine bromide.
| Compound Name | 4-[1-[(Z)-3-phenylprop-2-enyl]pyridin-1-ium-3-yl]sulfonylmorpholine bromide |
|---|---|
| PubChem CID | 45049666 |
| Molecular Formula | C18H21BrN2O3S |
| Molecular Weight | 425.35 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | 4-[1-[(Z)-3-phenylprop-2-enyl]pyridin-1-ium-3-yl]sulfonylmorpholine bromide |
| SMILES | O=S(=O)(c1ccc[n+](C/C=C\c2ccccc2)c1)N1CCOCC1.[Br-] |
| InChI | InChI=1S/C18H21N2O3S.BrH/c21-24(22,20-12-14-23-15-13-20)18-9-5-11-19(16-18)10-4-8-17-6-2-1-3-7-17;/h1-9,11,16H,10,12-15H2;1H/q+1;/p-1/b8-4-; |
| InChIKey | PLZJEFBPMXWYLQ-ZYFYRQFPSA-M |
| XLogP | -1.29 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.35 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|