C18H16ClIN2S — CID 45049730
7-chloro-3,10-dimethyl-5-phenyl-5H-[1,3]thiazolo[2,3-b]quinazolin-4-ium iodide (PubChem CID 45049730) has the molecular formula C18H16ClIN2S and a molecular weight of 454.76 g/mol. Its IUPAC name is 7-chloro-3,10-dimethyl-5-phenyl-5H-[1,3]thiazolo[2,3-b]quinazolin-4-ium iodide.
| Compound Name | 7-chloro-3,10-dimethyl-5-phenyl-5H-[1,3]thiazolo[2,3-b]quinazolin-4-ium iodide |
|---|---|
| PubChem CID | 45049730 |
| Molecular Formula | C18H16ClIN2S |
| Molecular Weight | 454.76 g/mol |
| Exact Mass | 453.98 |
| IUPAC Name | 7-chloro-3,10-dimethyl-5-phenyl-5H-[1,3]thiazolo[2,3-b]quinazolin-4-ium iodide |
| SMILES | Cc1csc2[n+]1C(c1ccccc1)c1cc(Cl)ccc1N2C.[I-] |
| InChI | InChI=1S/C18H16ClN2S.HI/c1-12-11-22-18-20(2)16-9-8-14(19)10-15(16)17(21(12)18)13-6-4-3-5-7-13;/h3-11,17H,1-2H3;1H/q+1;/p-1 |
| InChIKey | FBEFWHFAYYVEEE-UHFFFAOYSA-M |
| XLogP | 1.72 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.76 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|