C20H18BrN3O3 — CID 45053590
2-[4-(2,4-dimethylphenyl)pyrimidin-1-ium-1-yl]-1-(3-nitrophenyl)ethanone bromide (PubChem CID 45053590) has the molecular formula C20H18BrN3O3 and a molecular weight of 428.29 g/mol. Its IUPAC name is 2-[4-(2,4-dimethylphenyl)pyrimidin-1-ium-1-yl]-1-(3-nitrophenyl)ethanone bromide.
| Compound Name | 2-[4-(2,4-dimethylphenyl)pyrimidin-1-ium-1-yl]-1-(3-nitrophenyl)ethanone bromide |
|---|---|
| PubChem CID | 45053590 |
| Molecular Formula | C20H18BrN3O3 |
| Molecular Weight | 428.29 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | 2-[4-(2,4-dimethylphenyl)pyrimidin-1-ium-1-yl]-1-(3-nitrophenyl)ethanone bromide |
| SMILES | Cc1ccc(-c2cc[n+](CC(=O)c3cccc([N+](=O)[O-])c3)cn2)c(C)c1.[Br-] |
| InChI | InChI=1S/C20H18N3O3.BrH/c1-14-6-7-18(15(2)10-14)19-8-9-22(13-21-19)12-20(24)16-4-3-5-17(11-16)23(25)26;/h3-11,13H,12H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | URDIMMDDLLALSC-UHFFFAOYSA-M |
| XLogP | 0.45 |
| TPSA | 76.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.29 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|