About 6-nitroquinoxaline-2,3-dione;hydrate
6-nitroquinoxaline-2,3-dione;hydrate (PubChem CID 45074663) has the molecular formula C8H5N3O5
and a molecular weight of 223.14 g/mol. Its IUPAC name is 6-nitroquinoxaline-2,3-dione;hydrate.
Molecular Properties
| Compound Name | 6-nitroquinoxaline-2,3-dione;hydrate |
| PubChem CID | 45074663 |
| Molecular Formula | C8H5N3O5 |
| Molecular Weight | 223.14 g/mol |
| Exact Mass | 223.02 |
| IUPAC Name | 6-nitroquinoxaline-2,3-dione;hydrate |
| SMILES | O.O=C1N=c2ccc([N+](=O)[O-])cc2=NC1=O |
| InChI | InChI=1S/C8H3N3O4.H2O/c12-7-8(13)10-6-3-4(11(14)15)1-2-5(6)9-7;/h1-3H;1H2 |
| InChIKey | SNQFYARSPVQDFK-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 133.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.14 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-nitroquinoxaline-2,3-dione;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-nitroquinoxaline-2,3-dione;hydrate?
The IUPAC name of 6-nitroquinoxaline-2,3-dione;hydrate (CID 45074663) is 6-nitroquinoxaline-2,3-dione;hydrate.
What is the SMILES notation for 6-nitroquinoxaline-2,3-dione;hydrate?
The canonical SMILES for 6-nitroquinoxaline-2,3-dione;hydrate is O.O=C1N=c2ccc([N+](=O)[O-])cc2=NC1=O.
What is the InChIKey of 6-nitroquinoxaline-2,3-dione;hydrate?
The InChIKey is SNQFYARSPVQDFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3N3O4.H2O/c12-7-8(13)10-6-3-4(11(14)15)1-2-5(6)9-7;/h1-3H;1H2.
What are the key properties of 6-nitroquinoxaline-2,3-dione;hydrate?
6-nitroquinoxaline-2,3-dione;hydrate has a molecular weight of 223.14 g/mol, XLogP of -1.92, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-nitroquinoxaline-2,3-dione;hydrate is sourced from PubChem (CID 45074663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).