C17H22ClN7O — CID 45076391
6-chloro-2-[1-[[1-(2-methoxyethyl)tetrazol-5-yl]methyl]piperidin-4-yl]-1H-benzimidazole (PubChem CID 45076391) has the molecular formula C17H22ClN7O and a molecular weight of 375.86 g/mol. Its IUPAC name is 6-chloro-2-[1-[[1-(2-methoxyethyl)tetrazol-5-yl]methyl]piperidin-4-yl]-1H-benzimidazole.
| Compound Name | 6-chloro-2-[1-[[1-(2-methoxyethyl)tetrazol-5-yl]methyl]piperidin-4-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 45076391 |
| Molecular Formula | C17H22ClN7O |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 6-chloro-2-[1-[[1-(2-methoxyethyl)tetrazol-5-yl]methyl]piperidin-4-yl]-1H-benzimidazole |
| SMILES | COCCn1nnnc1CN1CCC(c2nc3ccc(Cl)cc3[nH]2)CC1 |
| InChI | InChI=1S/C17H22ClN7O/c1-26-9-8-25-16(21-22-23-25)11-24-6-4-12(5-7-24)17-19-14-3-2-13(18)10-15(14)20-17/h2-3,10,12H,4-9,11H2,1H3,(H,19,20) |
| InChIKey | LZSQVCJCTDDIMX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |