C9H12N4 — CID 45078021
2-N-ethylbenzimidazole-1,2-diamine (PubChem CID 45078021) has the molecular formula C9H12N4 and a molecular weight of 176.22 g/mol. Its IUPAC name is 2-N-ethylbenzimidazole-1,2-diamine.
| Compound Name | 2-N-ethylbenzimidazole-1,2-diamine |
|---|---|
| PubChem CID | 45078021 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 2-N-ethylbenzimidazole-1,2-diamine |
| SMILES | CCNc1nc2ccccc2n1N |
| InChI | InChI=1S/C9H12N4/c1-2-11-9-12-7-5-3-4-6-8(7)13(9)10/h3-6H,2,10H2,1H3,(H,11,12) |
| InChIKey | BLLADJXNRYOKDG-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |