C7H11NO — CID 45078720
(6-aminocyclohexa-2,4-dien-1-yl)methanol (PubChem CID 45078720) has the molecular formula C7H11NO and a molecular weight of 125.17 g/mol. Its IUPAC name is (6-aminocyclohexa-2,4-dien-1-yl)methanol.
| Compound Name | (6-aminocyclohexa-2,4-dien-1-yl)methanol |
|---|---|
| PubChem CID | 45078720 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | (6-aminocyclohexa-2,4-dien-1-yl)methanol |
| SMILES | NC1C=CC=CC1CO |
| InChI | InChI=1S/C7H11NO/c8-7-4-2-1-3-6(7)5-9/h1-4,6-7,9H,5,8H2 |
| InChIKey | BEPWZVINEFITLY-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |