C6H11NO2S — CID 45082403
methyl (4R)-2-methyl-1,3-thiazolidine-4-carboxylate (PubChem CID 45082403) has the molecular formula C6H11NO2S and a molecular weight of 161.23 g/mol. Its IUPAC name is methyl (4R)-2-methyl-1,3-thiazolidine-4-carboxylate.
| Compound Name | methyl (4R)-2-methyl-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 45082403 |
| Molecular Formula | C6H11NO2S |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | methyl (4R)-2-methyl-1,3-thiazolidine-4-carboxylate |
| SMILES | COC(=O)[C@@H]1CSC(C)N1 |
| InChI | InChI=1S/C6H11NO2S/c1-4-7-5(3-10-4)6(8)9-2/h4-5,7H,3H2,1-2H3/t4?,5-/m0/s1 |
| InChIKey | SIHORGCAHLFPHD-AKGZTFGVSA-N |
| XLogP | 0.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |