C6H9NO2 — CID 45086570
(5S)-3,5-dimethyl-2,5-dihydro-1,4-oxazin-6-one (PubChem CID 45086570) has the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. Its IUPAC name is (5S)-3,5-dimethyl-2,5-dihydro-1,4-oxazin-6-one.
| Compound Name | (5S)-3,5-dimethyl-2,5-dihydro-1,4-oxazin-6-one |
|---|---|
| PubChem CID | 45086570 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | (5S)-3,5-dimethyl-2,5-dihydro-1,4-oxazin-6-one |
| SMILES | CC1=N[C@@H](C)C(=O)OC1 |
| InChI | InChI=1S/C6H9NO2/c1-4-3-9-6(8)5(2)7-4/h5H,3H2,1-2H3/t5-/m0/s1 |
| InChIKey | JEKCRYNAZBTYFS-YFKPBYRVSA-N |
| XLogP | 0.39 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |