C5H9N3S — CID 45087956
5-N,5-N-dimethyl-1,3-thiazole-2,5-diamine (PubChem CID 45087956) has the molecular formula C5H9N3S and a molecular weight of 143.22 g/mol. Its IUPAC name is 5-N,5-N-dimethyl-1,3-thiazole-2,5-diamine.
| Compound Name | 5-N,5-N-dimethyl-1,3-thiazole-2,5-diamine |
|---|---|
| PubChem CID | 45087956 |
| Molecular Formula | C5H9N3S |
| Molecular Weight | 143.22 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | 5-N,5-N-dimethyl-1,3-thiazole-2,5-diamine |
| SMILES | CN(C)c1cnc(N)s1 |
| InChI | InChI=1S/C5H9N3S/c1-8(2)4-3-7-5(6)9-4/h3H,1-2H3,(H2,6,7) |
| InChIKey | CHADUMJSOSHUAO-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.22 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |