C5H6N2O4 — CID 45088579
1-(2-hydroxyethyl)imidazolidine-2,4,5-trione (PubChem CID 45088579) has the molecular formula C5H6N2O4 and a molecular weight of 158.11 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)imidazolidine-2,4,5-trione.
| Compound Name | 1-(2-hydroxyethyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 45088579 |
| Molecular Formula | C5H6N2O4 |
| Molecular Weight | 158.11 g/mol |
| Exact Mass | 158.03 |
| IUPAC Name | 1-(2-hydroxyethyl)imidazolidine-2,4,5-trione |
| SMILES | O=C1NC(=O)N(CCO)C1=O |
| InChI | InChI=1S/C5H6N2O4/c8-2-1-7-4(10)3(9)6-5(7)11/h8H,1-2H2,(H,6,9,11) |
| InChIKey | DJMPQFPACCOZLI-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.11 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|