About [(2R)-pyrrolidin-2-yl] butanoate
[(2R)-pyrrolidin-2-yl] butanoate (PubChem CID 45090959) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is [(2R)-pyrrolidin-2-yl] butanoate.
Molecular Properties
| Compound Name | [(2R)-pyrrolidin-2-yl] butanoate |
| PubChem CID | 45090959 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | [(2R)-pyrrolidin-2-yl] butanoate |
| SMILES | CCCC(=O)O[C@@H]1CCCN1 |
| InChI | InChI=1S/C8H15NO2/c1-2-4-8(10)11-7-5-3-6-9-7/h7,9H,2-6H2,1H3/t7-/m1/s1 |
| InChIKey | CYKHFITVGCMPEC-SSDOTTSWSA-N |
| XLogP | 1.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2R)-pyrrolidin-2-yl] butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-pyrrolidin-2-yl] butanoate?
The IUPAC name of [(2R)-pyrrolidin-2-yl] butanoate (CID 45090959) is [(2R)-pyrrolidin-2-yl] butanoate.
What is the SMILES notation for [(2R)-pyrrolidin-2-yl] butanoate?
The canonical SMILES for [(2R)-pyrrolidin-2-yl] butanoate is CCCC(=O)O[C@@H]1CCCN1.
What is the InChIKey of [(2R)-pyrrolidin-2-yl] butanoate?
The InChIKey is CYKHFITVGCMPEC-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H15NO2/c1-2-4-8(10)11-7-5-3-6-9-7/h7,9H,2-6H2,1H3/t7-/m1/s1.
What are the key properties of [(2R)-pyrrolidin-2-yl] butanoate?
[(2R)-pyrrolidin-2-yl] butanoate has a molecular weight of 157.21 g/mol, XLogP of 1.04, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-pyrrolidin-2-yl] butanoate is sourced from PubChem (CID 45090959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).