About hexyl pyrrolidin-2-yl carbonate
hexyl pyrrolidin-2-yl carbonate (PubChem CID 54505278) has the molecular formula C11H21NO3
and a molecular weight of 215.29 g/mol. Its IUPAC name is hexyl pyrrolidin-2-yl carbonate.
Molecular Properties
| Compound Name | hexyl pyrrolidin-2-yl carbonate |
| PubChem CID | 54505278 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | hexyl pyrrolidin-2-yl carbonate |
| SMILES | CCCCCCOC(=O)OC1CCCN1 |
| InChI | InChI=1S/C11H21NO3/c1-2-3-4-5-9-14-11(13)15-10-7-6-8-12-10/h10,12H,2-9H2,1H3 |
| InChIKey | ZOGGBYNRVHIBQH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexyl pyrrolidin-2-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl pyrrolidin-2-yl carbonate?
The IUPAC name of hexyl pyrrolidin-2-yl carbonate (CID 54505278) is hexyl pyrrolidin-2-yl carbonate.
What is the SMILES notation for hexyl pyrrolidin-2-yl carbonate?
The canonical SMILES for hexyl pyrrolidin-2-yl carbonate is CCCCCCOC(=O)OC1CCCN1.
What is the InChIKey of hexyl pyrrolidin-2-yl carbonate?
The InChIKey is ZOGGBYNRVHIBQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3/c1-2-3-4-5-9-14-11(13)15-10-7-6-8-12-10/h10,12H,2-9H2,1H3.
What are the key properties of hexyl pyrrolidin-2-yl carbonate?
hexyl pyrrolidin-2-yl carbonate has a molecular weight of 215.29 g/mol, XLogP of 2.43, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl pyrrolidin-2-yl carbonate is sourced from PubChem (CID 54505278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).